CymitQuimica logo

CAS 1219828-05-3

:

3,5-Dimethoxy-4-(1-methylethoxy)benzonitrile

Description:
3,5-Dimethoxy-4-(1-methylethoxy)benzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a benzonitrile functional group. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound features a nitrile group, which is known for its polar character and ability to participate in various chemical reactions, such as nucleophilic additions. The 1-methylethoxy substituent adds steric bulk, potentially affecting the compound's overall reactivity and physical properties, such as boiling and melting points. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopy methods like NMR and mass spectrometry for confirmation of its structure. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-8(2)16-12-10(14-3)5-9(7-13)6-11(12)15-4/h5-6,8H,1-4H3
InChI key:InChIKey=GVNSCHRAFUYELV-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(OC)C=C(C#N)C=C1OC
Synonyms:
  • Benzonitrile, 3,5-dimethoxy-4-(1-methylethoxy)-
  • 3,5-Dimethoxy-4-(1-methylethoxy)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.