CAS 1219828-13-3

2-(2-Pyrimidinylamino)-4-thiazoleacetic acid

Description:

2-(2-Pyrimidinylamino)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a thiazole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amino acids, making it of interest in various fields, including medicinal chemistry and biochemistry. The presence of the pyrimidine and thiazole rings suggests potential biological activity, possibly as an enzyme inhibitor or in other therapeutic applications. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, which can influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit specific stereochemical configurations that can affect its pharmacokinetics and pharmacodynamics. Overall, 2-(2-Pyrimidinylamino)-4-thiazoleacetic acid represents a class of compounds that may have significant implications in drug development and research, particularly in targeting specific biological pathways.

Formula: C₉H₈N₄O₂S

InChI: InChI=1S/C9H8N4O2S/c14-7(15)4-6-5-16-9(12-6)13-8-10-2-1-3-11-8/h1-3,5H,4H2,(H,14,15)(H,10,11,12,13)

InChI key: InChIKey=UFBPFVSHWCAGIQ-UHFFFAOYSA-N

SMILES: N(C1=NC(CC(O)=O)=CS1)C=2N=CC=CN2

Synonyms:

• 2-(2-Pyrimidinylamino)-4-thiazoleacetic acid
• 4-Thiazoleacetic acid, 2-(2-pyrimidinylamino)-

2-(2-(Pyrimidin-2-ylamino)thiazol-4-yl)acetic acid

CAS: 1219828-13-3

2-(2-(Pyrimidin-2-ylamino)thiazol-4-yl)acetic acid

Purity: 95%

Molecular weight: 236.26g/mol

Ref: 54-OR1073190

2-(4-(Pyrimidin-2-ylamino)-3,5-thiazolyl)acetic acid

CAS: 1219828-13-3

Please enquire for more information about 2-(4-(Pyrimidin-2-ylamino)-3,5-thiazolyl)acetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FP169272