CAS 1219828-28-0

2-(Acetylamino)-4,5,6,7-tetrahydro-4-benzothiazolecarboxylic acid

Description:

2-(Acetylamino)-4,5,6,7-tetrahydro-4-benzothiazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a tetrahydro moiety and an acetylamino group. This compound typically exhibits properties associated with both acidic and amine functionalities, making it potentially useful in various chemical reactions and applications. The presence of the benzothiazole ring suggests that it may possess biological activity, as many benzothiazole derivatives are known for their pharmacological properties. The tetrahydro structure contributes to its stability and solubility in organic solvents. Additionally, the carboxylic acid group indicates that it can participate in acid-base reactions, potentially forming salts or esters. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its structural features that could interact with biological targets. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₀H₁₂N₂O₃S

InChI: InChI=1S/C10H12N2O3S/c1-5(13)11-10-12-8-6(9(14)15)3-2-4-7(8)16-10/h6H,2-4H2,1H3,(H,14,15)(H,11,12,13)

InChI key: InChIKey=WUCUXHMWENQAFO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2=C(SC(NC(C)=O)=N2)CCC1

Synonyms:

• 2-(Acetylamino)-4,5,6,7-tetrahydro-4-benzothiazolecarboxylic acid
• 4-Benzothiazolecarboxylic acid, 2-(acetylamino)-4,5,6,7-tetrahydro-