CAS 1219937-97-9
:1-[2-Amino-5-methoxy-4-[3-(4-morpholinyl)propoxy]phenyl]ethanone
Description:
1-[2-Amino-5-methoxy-4-[3-(4-morpholinyl)propoxy]phenyl]ethanone, with the CAS number 1219937-97-9, is a synthetic organic compound characterized by its complex molecular structure, which includes an ethanone functional group, an amino group, and a methoxy substituent on a phenyl ring. The presence of a morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit properties such as moderate to high solubility in organic solvents, and its polar functional groups could influence its interaction with biological systems. The specific arrangement of substituents can affect its pharmacokinetics and pharmacodynamics, making it a candidate for further research in drug development. Additionally, the compound's stability, reactivity, and potential biological activity would be of interest in various chemical and pharmaceutical applications. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C16H24N2O4
InChI:InChI=1S/C16H24N2O4/c1-12(19)13-10-15(20-2)16(11-14(13)17)22-7-3-4-18-5-8-21-9-6-18/h10-11H,3-9,17H2,1-2H3
InChI key:InChIKey=ZWEPCYWPLPABBS-UHFFFAOYSA-N
SMILES:O(CCCN1CCOCC1)C2=C(OC)C=C(C(C)=O)C(N)=C2
Synonyms:- Ethanone, 1-[2-amino-5-methoxy-4-[3-(4-morpholinyl)propoxy]phenyl]-
- 1-[2-Amino-5-methoxy-4-(3-(morpholin-4-yl)propoxy)phenyl]ethanone
- 1-[2-Amino-5-methoxy-4-[3-(4-morpholinyl)propoxy]phenyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.