CAS 1219948-55-6

Benzeneacetic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Benzeneacetic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a piperidine ring, which contributes to its pharmacological properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar and non-polar characteristics. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous solutions. The piperidine moiety is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Its structure suggests potential applications in the development of pharmaceuticals, particularly in the treatment of neurological or psychiatric disorders. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.

Formula: C₁₅H₂₁NO₂·ClH

InChI: InChI=1S/C15H21NO2.ClH/c17-15(12-14-4-2-1-3-5-14)18-11-8-13-6-9-16-10-7-13;/h1-5,13,16H,6-12H2;1H

InChI key: InChIKey=AIFBVJZVBAARAR-UHFFFAOYSA-N

SMILES: C(C(OCCC1CCNCC1)=O)C2=CC=CC=C2.Cl

Synonyms:

• Benzeneacetic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)