CAS 1219948-58-9

Butanoic acid, 3-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Butanoic acid, 3-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, derived from butanoic acid and a piperidine derivative. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The piperidine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the butanoic acid moiety suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific therapeutic effects. Its molecular structure indicates that it may interact with biological systems, possibly influencing neurotransmitter pathways or other physiological processes. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, and appropriate laboratory safety protocols should be followed when working with this compound.

Formula: C₁₂H₂₃NO₂·ClH

InChI: InChI=1S/C12H23NO2.ClH/c1-10(2)9-12(14)15-8-5-11-3-6-13-7-4-11;/h10-11,13H,3-9H2,1-2H3;1H

InChI key: InChIKey=AZDOWRCAQRWSCM-UHFFFAOYSA-N

SMILES: C(COC(CC(C)C)=O)C1CCNCC1.Cl

Synonyms:

• Butanoic acid, 3-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)