
CAS 1219948-59-0
:Propanoic acid, 2-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)
Description:
Propanoic acid, 2-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1), with the CAS number 1219948-59-0, is a chemical compound characterized by its ester functional group derived from propanoic acid and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydrochloride form. The presence of the piperidine ring suggests potential pharmacological properties, as piperidine derivatives are often associated with various biological activities, including analgesic and anti-inflammatory effects. The compound's structure indicates it may interact with biological systems, potentially influencing neurotransmitter pathways. As with many esters, it may exhibit moderate volatility and can undergo hydrolysis in the presence of water, reverting to its acid and alcohol components. Safety data should be consulted for handling and exposure guidelines, as the compound may pose health risks typical of organic acids and amines. Overall, its unique structure and properties make it of interest in both synthetic chemistry and medicinal applications.
Formula:C11H21NO2·ClH
InChI:InChI=1S/C11H21NO2.ClH/c1-9(2)11(13)14-8-5-10-3-6-12-7-4-10;/h9-10,12H,3-8H2,1-2H3;1H
InChI key:InChIKey=XUONPHFKWUBKLZ-UHFFFAOYSA-N
SMILES:C(COC(C(C)C)=O)C1CCNCC1.Cl
Synonyms:- Propanoic acid, 2-methyl-, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.