CAS 1219948-63-6

Cyclobutanecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

Description:

Cyclobutanecarboxamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a cyclobutane ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. The hydrochloride form indicates that the compound is a salt, which can influence its stability and bioavailability. In terms of safety, like many amides and cyclic compounds, it may pose certain hazards, and appropriate handling precautions should be observed. Its specific applications and effects would depend on further research and context within medicinal chemistry or related fields. Overall, this compound represents a unique structure that may have implications in drug development or other chemical applications.

Formula: C₁₀H₁₈N₂O·ClH

InChI: InChI=1S/C10H18N2O.ClH/c13-10(8-2-1-3-8)12-9-4-6-11-7-5-9;/h8-9,11H,1-7H2,(H,12,13);1H

InChI key: InChIKey=VZUFQIRXZWZSAI-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)(=O)C2CCC2.Cl

Synonyms:

• Cyclobutanecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

N-(Piperidin-4-yl)cyclobutanecarboxamidehydrochloride

CAS: 1219948-63-6

Purity: 95.0%

Molecular weight: 218.72999572753906

Ref: 10-F063451