CAS 1219948-67-0
:3-[(5-Chloro[1,1′-biphenyl]-2-yl)oxy]azetidine
Description:
3-[(5-Chloro[1,1′-biphenyl]-2-yl)oxy]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 5-chloro[1,1′-biphenyl]-2-yl group indicates that the compound has a biphenyl moiety substituted with a chlorine atom, contributing to its potential biological activity and hydrophobic characteristics. The ether-like linkage (–O–) between the biphenyl and the azetidine ring suggests that the compound may exhibit unique solubility properties and reactivity patterns. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its interaction with biological targets. Additionally, the chlorine substituent may enhance lipophilicity and alter pharmacokinetic properties. Overall, the compound's unique structural characteristics may provide insights into its potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C15H14ClNO
InChI:InChI=1S/C15H14ClNO/c16-12-6-7-15(18-13-9-17-10-13)14(8-12)11-4-2-1-3-5-11/h1-8,13,17H,9-10H2
InChI key:InChIKey=VWYVMFWKHSUUOW-UHFFFAOYSA-N
SMILES:O(C1=C(C=C(Cl)C=C1)C2=CC=CC=C2)C3CNC3
Synonyms:- 3-[(5-Chloro[1,1′-biphenyl]-2-yl)oxy]azetidine
- Azetidine, 3-[(5-chloro[1,1′-biphenyl]-2-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.