CAS 1219948-69-2: 3-(4-Chloro-2-nitrophenoxy)azetidine

Description: 3-(4-Chloro-2-nitrophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-chloro-2-nitrophenoxy group indicates that the compound features a phenolic moiety substituted with both a chlorine atom and a nitro group, contributing to its chemical reactivity and potential biological activity. This compound may exhibit properties typical of both azetidines and substituted phenols, such as varying degrees of polarity, solubility in organic solvents, and potential interactions with biological targets. The chlorine and nitro substituents can influence the compound's electronic properties, potentially affecting its reactivity and stability. As with many heterocyclic compounds, 3-(4-Chloro-2-nitrophenoxy)azetidine may have applications in medicinal chemistry, agrochemicals, or materials science, depending on its specific properties and biological activity. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₉ClN₂O₃

InChI: InChI=1S/C9H9ClN2O3/c10-6-1-2-9(8(3-6)12(13)14)15-7-4-11-5-7/h1-3,7,11H,4-5H2

InChI key: InChIKey=VCKGZIKKTZQBHV-UHFFFAOYSA-N

SMILES: O=N(=O)C1=CC(Cl)=CC=C1OC2CNC2

3-(4-Chloro-2-nitrophenoxy)azetidine

CAS: 1219948-69-2

• Purity: 95+%
• Molecular weight: 228.6300048828125

3-(4-Chloro-2-nitrophenoxy)azetidine

CAS: 1219948-69-2

Versatile small molecule scaffold

• Formula: C₉H₉ClN₂O₃
• Purity: Min. 95%
• Molecular weight: 228.63 g/mol