CymitQuimica logo

CAS 1219948-72-7

:

3-(2,3-Dichlorophenoxy)azetidine

Description:
3-(2,3-Dichlorophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,3-dichlorophenoxy group indicates that the compound has a phenolic moiety substituted with two chlorine atoms at the second and third positions, contributing to its potential biological activity and chemical reactivity. This compound may exhibit properties typical of both azetidine derivatives and chlorinated aromatic compounds, such as increased lipophilicity and potential interactions with biological targets. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The specific characteristics, such as solubility, stability, and reactivity, would depend on the overall molecular interactions and the environment in which the compound is used. As with many synthetic compounds, safety and handling precautions are essential due to the presence of chlorine, which can impart toxicity and environmental concerns.
Formula:C9H9Cl2NO
InChI:InChI=1S/C9H9Cl2NO/c10-7-2-1-3-8(9(7)11)13-6-4-12-5-6/h1-3,6,12H,4-5H2
InChI key:InChIKey=SORWUTJILOQVHX-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(Cl)=CC=C1)C2CNC2
Synonyms:
  • 3-(2,3-Dichlorophenoxy)azetidine
  • Azetidine, 3-(2,3-dichlorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.