CAS 1219948-76-1
:3-(4-Iodophenoxy)azetidine
Description:
3-(4-Iodophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-iodophenoxy group indicates that there is a phenyl ring substituted with an iodine atom and connected via an ether linkage to the azetidine. This compound may exhibit unique physical and chemical properties due to the presence of the iodine atom, which can influence its reactivity and interactions with other molecules. The iodine substitution can enhance lipophilicity and potentially affect biological activity, making it of interest in medicinal chemistry. Additionally, the azetidine ring can participate in various chemical reactions, such as nucleophilic substitutions or ring-opening reactions, depending on the conditions. The compound's specific characteristics, such as solubility, melting point, and reactivity, would typically be determined through experimental methods and may vary based on the environment in which it is studied.
Formula:C9H10INO
InChI:InChI=1S/C9H10INO/c10-7-1-3-8(4-2-7)12-9-5-11-6-9/h1-4,9,11H,5-6H2
InChI key:InChIKey=NEJYPHMSMQSEOM-UHFFFAOYSA-N
SMILES:O(C1=CC=C(I)C=C1)C2CNC2
Synonyms:- 3-(4-Iodophenoxy)azetidine
- Azetidine, 3-(4-iodophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.