
CAS 1219948-82-9
:Methyl 4-(3-azetidinyloxy)benzoate
Description:
Methyl 4-(3-azetidinyloxy)benzoate, identified by its CAS number 1219948-82-9, is an organic compound characterized by its ester functional group and the presence of an azetidine ring. This compound features a methyl ester derived from p-aminobenzoic acid, with a 3-azetidinyloxy substituent that contributes to its unique chemical properties. The azetidine ring, a four-membered saturated heterocycle, introduces potential for various chemical reactivity and biological activity. Methyl 4-(3-azetidinyloxy)benzoate may exhibit moderate solubility in organic solvents, while its polar functional groups can influence its interactions in biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Additionally, its synthesis and reactivity can be of interest in organic synthesis and material science. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-14-11(13)8-2-4-9(5-3-8)15-10-6-12-7-10/h2-5,10,12H,6-7H2,1H3
InChI key:InChIKey=JTHDHLXXKXNEIB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(OC2CNC2)C=C1
Synonyms:- Methyl 4-(3-azetidinyloxy)benzoate
- Benzoic acid, 4-(3-azetidinyloxy)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.