CAS 1219948-86-3
:3-(2-Nitrophenoxy)azetidine
Description:
3-(2-Nitrophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a nitrophenoxy group indicates that the compound has a nitro group (-NO2) attached to a phenyl ring, which is further connected to the azetidine via an ether linkage. This structural arrangement contributes to its potential reactivity and biological activity. The nitro group is known for its electron-withdrawing properties, which can influence the compound's chemical behavior, including its solubility and reactivity with nucleophiles. Additionally, the azetidine ring can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Its specific applications may vary, but compounds with similar structures are often explored for their potential as pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards in terms of toxicity and environmental impact.
Formula:C9H10N2O3
InChI:InChI=1S/C9H10N2O3/c12-11(13)8-3-1-2-4-9(8)14-7-5-10-6-7/h1-4,7,10H,5-6H2
InChI key:InChIKey=GQHOCWKTNHUTFL-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=CC=C1)C2CNC2
Synonyms:- 3-(2-Nitrophenoxy)azetidine
- Azetidine, 3-(2-nitrophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
