CAS 1219949-02-6

Pyrrolidine, 3-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 4-chloro-3-ethylphenoxy group indicates that it has a phenolic structure with a chlorine substituent and an ethyl group, contributing to its overall hydrophobic character. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various biological activities, potentially acting as a ligand or modulator in biochemical pathways. Its specific properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data sheets and material safety data should be consulted for handling and toxicity information, as with any chemical compound. Overall, this substance is of interest in medicinal chemistry and pharmacology, warranting further investigation into its potential therapeutic uses.

Formula: C₁₃H₁₈ClNO·ClH

InChI: InChI=1S/C13H18ClNO.ClH/c1-2-11-7-12(3-4-13(11)14)16-9-10-5-6-15-8-10;/h3-4,7,10,15H,2,5-6,8-9H2,1H3;1H

InChI key: InChIKey=SNNRHAOKYKOPFM-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC(CC)=C(Cl)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1)