
CAS 1219949-08-2
:Piperidine, 3-[2-(pentyloxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(pentyloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a pentyloxyethyl side chain enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit properties associated with piperidine derivatives, such as acting as a ligand or influencing neurotransmitter systems. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. The hydrochloride form is commonly used in research and development due to its improved handling characteristics. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C12H26ClNO
InChI:InChI=1S/C12H25NO.ClH/c1-2-3-4-9-14-10-7-12-6-5-8-13-11-12;/h12-13H,2-11H2,1H3;1H
InChI key:InChIKey=FDCIEDFSCVFPQQ-UHFFFAOYSA-N
SMILES:C(COCCCCC)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-[2-(pentyloxy)ethyl]-, hydrochloride (1:1)
- 3-[2-(Pentyloxy)ethyl]piperidine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.