CAS 1219949-14-0

Pyrrolidine, 3-[[[4-(1-methylethyl)phenyl]methoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[[4-(1-methylethyl)phenyl]methoxy]methyl]-, hydrochloride (1:1), with CAS number 1219949-14-0, is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a methoxy group attached to a phenyl ring, specifically a para-substituted isopropylphenyl moiety, contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a specific class of organic molecules with potential applications in medicinal chemistry and related fields.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-12(2)15-5-3-13(4-6-15)10-17-11-14-7-8-16-9-14;/h3-6,12,14,16H,7-11H2,1-2H3;1H

InChI key: InChIKey=UJJOOPIAVISRPO-UHFFFAOYSA-N

SMILES: C(C)(C)C1=CC=C(COCC2CCNC2)C=C1.Cl

Synonyms:

• Pyrrolidine, 3-[[[4-(1-methylethyl)phenyl]methoxy]methyl]-, hydrochloride (1:1)
• 3-(((4-Isopropylbenzyl)oxy)methyl)pyrrolidine hydrochloride