CAS 1219949-30-0

Piperidine, 4-[2-(2-propylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(2-propylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxyethyl side chain with a propyl group, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their effects on the central nervous system and other therapeutic areas. The compound's molecular structure may influence its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a specific class of piperidine derivatives with potential applications in medicinal chemistry.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-2-5-15-6-3-4-7-16(15)18-13-10-14-8-11-17-12-9-14;/h3-4,6-7,14,17H,2,5,8-13H2,1H3;1H

InChI key: InChIKey=ZYTSDXXVGJIOMK-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=C(CCC)C=CC=C2.Cl

Synonyms:

• Piperidine, 4-[2-(2-propylphenoxy)ethyl]-, hydrochloride (1:1)