
CAS 1219949-33-3
:Piperidine, 4-[2-(3-chlorophenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-(3-chlorophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a 3-chlorophenoxyethyl substituent at the 4-position of the piperidine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals. The presence of the chlorophenoxy group may impart specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c14-12-2-1-3-13(10-12)16-9-6-11-4-7-15-8-5-11;/h1-3,10-11,15H,4-9H2;1H
InChI key:InChIKey=VVSHUECDMSJTGT-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=CC(Cl)=CC=C2.Cl
Synonyms:- Piperidine, 4-[2-(3-chlorophenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.