CAS 1219949-42-4

Piperidine, 2-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1), with CAS number 1219949-42-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a branched alkyl chain, specifically a 5-methyl-2-(1-methylethyl)phenyl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the piperidine moiety often imparts basicity, allowing it to interact with biological systems effectively. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and form of the substance. Safety data should be consulted for handling and storage, as with any chemical compound.

Formula: C₁₇H₂₇NO·ClH

InChI: InChI=1S/C17H27NO.ClH/c1-13(2)16-8-7-14(3)12-17(16)19-11-9-15-6-4-5-10-18-15;/h7-8,12-13,15,18H,4-6,9-11H2,1-3H3;1H

InChI key: InChIKey=YAQUCMWIBPGSPZ-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(C(C)C)C=CC(C)=C2.Cl

Synonyms:

• Piperidine, 2-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1)