CAS 1219949-43-5

Piperidine, 4-[[(4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[[4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a methoxyphenyl group and a methoxy methyl substituent, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the methoxy groups can influence the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which may be explored for therapeutic purposes. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the context of drug development and synthesis.

Formula: C₁₄H₂₁NO₂·ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-16-14-4-2-12(3-5-14)10-17-11-13-6-8-15-9-7-13;/h2-5,13,15H,6-11H2,1H3;1H

InChI key: InChIKey=ALIHTYOUOPVZGW-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Piperidine, 4-[[(4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1)