CAS 1219949-45-7

N-(3-Amino-4-fluorophenyl)tetrahydro-2H-pyran-4-carboxamide

Description:

N-(3-Amino-4-fluorophenyl)tetrahydro-2H-pyran-4-carboxamide is a chemical compound characterized by its unique structural features, which include a tetrahydropyran ring and an amino group attached to a fluorophenyl moiety. This compound typically exhibits properties associated with both amides and aromatic amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amino group. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with other molecules. The presence of the tetrahydropyran structure may contribute to its conformational flexibility, which is important in drug design and molecular interactions. Additionally, compounds like this one are often studied for their potential pharmaceutical applications, particularly in the fields of medicinal chemistry and drug development, due to their ability to interact with biological targets. Overall, the characteristics of this compound make it a subject of interest in various chemical and biological research contexts.

Formula: C₁₂H₁₅FN₂O₂

InChI: InChI=1S/C12H15FN2O2/c13-10-2-1-9(7-11(10)14)15-12(16)8-3-5-17-6-4-8/h1-2,7-8H,3-6,14H2,(H,15,16)

InChI key: InChIKey=FEQKDIWILTUPBY-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCOCC1)C2=CC(N)=C(F)C=C2

Synonyms:

• N-(3-Amino-4-fluorophenyl)tetrahydro-2H-pyran-4-carboxamide
• 2H-Pyran-4-carboxamide, N-(3-amino-4-fluorophenyl)tetrahydro-