CymitQuimica logo

CAS 1219949-47-9

:

N-(4-Aminophenyl)tetrahydro-2H-pyran-4-carboxamide

Description:
N-(4-Aminophenyl)tetrahydro-2H-pyran-4-carboxamide is a chemical compound characterized by its unique structural features, which include a tetrahydro-pyran ring and an amine group attached to a phenyl ring. This compound typically exhibits properties associated with both amides and cyclic structures, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The tetrahydropyran moiety can impart stability and may affect the compound's conformational flexibility. Additionally, the carboxamide functional group can enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific molecular interactions and the presence of substituents. Overall, N-(4-Aminophenyl)tetrahydro-2H-pyran-4-carboxamide represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c13-10-1-3-11(4-2-10)14-12(15)9-5-7-16-8-6-9/h1-4,9H,5-8,13H2,(H,14,15)
InChI key:InChIKey=ICDBSHAHXMBYJA-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(N)C=C1)(=O)C2CCOCC2
Synonyms:
  • N-(4-Aminophenyl)tetrahydro-2H-pyran-4-carboxamide
  • 2H-Pyran-4-carboxamide, N-(4-aminophenyl)tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.