CymitQuimica logo

CAS 1219949-51-5

:

2-Pyridinecarboxylic acid, 4-chloro-, 4-piperidinyl ester, hydrochloride (1:1)

Description:
2-Pyridinecarboxylic acid, 4-chloro-, 4-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its structural components, which include a pyridine ring, a carboxylic acid moiety, and a piperidine group. The presence of the 4-chloro substituent on the pyridine ring contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of medicinal chemistry. Its specific interactions and effects would depend on the functional groups present and their spatial arrangement, which can influence its pharmacological profile. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C11H13ClN2O2·ClH
InChI:InChI=1S/C11H13ClN2O2.ClH/c12-8-1-6-14-10(7-8)11(15)16-9-2-4-13-5-3-9;/h1,6-7,9,13H,2-5H2;1H
InChI key:InChIKey=VYZHTNVUFKWJDS-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)(=O)C2=CC(Cl)=CC=N2.Cl
Synonyms:
  • 2-Pyridinecarboxylic acid, 4-chloro-, 4-piperidinyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.