
CAS 1219949-58-2
:Acetic acid, 2-chloro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Description:
Acetic acid, 2-chloro-, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a piperidine ring, which contributes to its pharmacological properties. The compound features a chloro substituent at the second position of the acetic acid moiety, enhancing its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for various applications, including pharmaceutical formulations. The piperidine structure is known for its role in medicinal chemistry, often associated with compounds that exhibit analgesic, anti-inflammatory, or central nervous system effects. The presence of the acetic acid component suggests potential applications in organic synthesis and as a building block in drug development. Overall, this compound's unique structural features and functional groups make it of interest in both research and therapeutic contexts, although specific biological activities and safety profiles would require further investigation.
Formula:C8H14ClNO2·ClH
InChI:InChI=1S/C8H14ClNO2.ClH/c9-5-8(11)12-6-7-1-3-10-4-2-7;/h7,10H,1-6H2;1H
InChI key:InChIKey=WBJBPYVNUMIJPE-UHFFFAOYSA-N
SMILES:C(OC(CCl)=O)C1CCNCC1.Cl
Synonyms:- Acetic acid, 2-chloro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.