
CAS 1219956-79-2
:Acetic acid, 2-chloro-, 3-pyrrolidinyl ester, hydrochloride (1:1)
Description:
Acetic acid, 2-chloro-, 3-pyrrolidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from acetic acid and a pyrrolidine moiety. The presence of a chlorine atom at the 2-position of the acetic acid component contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as moderate to high polarity due to the presence of both the ester and the hydrochloride functionalities. Its structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, this compound's unique structural features may lead to diverse applications in research and industry, particularly in the development of therapeutic agents.
Formula:C6H10ClNO2·ClH
InChI:InChI=1S/C6H10ClNO2.ClH/c7-3-6(9)10-5-1-2-8-4-5;/h5,8H,1-4H2;1H
InChI key:InChIKey=WCIJOASVXJXMFC-UHFFFAOYSA-N
SMILES:O(C(CCl)=O)C1CCNC1.Cl
Synonyms:- Acetic acid, 2-chloro-, 3-pyrrolidinyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.