CymitQuimica logo

CAS 1219956-81-6

:

3-[2-Bromo-4-(1-methylpropyl)phenoxy]azetidine

Description:
3-[2-Bromo-4-(1-methylpropyl)phenoxy]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, indicating the presence of a phenolic moiety bonded to an oxygen atom, which is further substituted with a bromine atom and a branched alkyl group (1-methylpropyl) at the para position. This substitution pattern contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the bromine atom may enhance its electrophilic nature, making it useful in various chemical reactions. Additionally, the azetidine ring can participate in nucleophilic substitution reactions due to the strain associated with the four-membered ring. Overall, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry and related fields. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H18BrNO
InChI:InChI=1S/C13H18BrNO/c1-3-9(2)10-4-5-13(12(14)6-10)16-11-7-15-8-11/h4-6,9,11,15H,3,7-8H2,1-2H3
InChI key:InChIKey=LMFHVFDNAPIOQX-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(C(CC)C)C=C1)C2CNC2
Synonyms:
  • Azetidine, 3-[2-bromo-4-(1-methylpropyl)phenoxy]-
  • 3-[2-Bromo-4-(1-methylpropyl)phenoxy]azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.