CAS 1219956-83-8

Pyrrolidine, 3-[(4-bromo-2-ethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-bromo-2-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 4-bromo-2-ethylphenoxy group indicates that the compound has a phenolic structure with a bromine substituent and an ethyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular structure suggests it could be involved in various chemical reactions, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of organic molecules with potential applications in medicinal chemistry and research.

Formula: C₁₃H₁₈BrNO·ClH

InChI: InChI=1S/C13H18BrNO.ClH/c1-2-11-7-12(14)3-4-13(11)16-9-10-5-6-15-8-10;/h3-4,7,10,15H,2,5-6,8-9H2,1H3;1H

InChI key: InChIKey=ZYFHLDUKCUOJAO-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=C(CC)C=C(Br)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-bromo-2-ethylphenoxy)methyl]-, hydrochloride (1:1)