CAS 1219956-97-4

Piperidine, 2-[2-[2-(1,1-dimethylethyl)-4-methylphenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[2-(1,1-dimethylethyl)-4-methylphenoxy]ethyl]-, hydrochloride (1:1), identified by CAS number 1219956-97-4, is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a complex side chain that includes a tert-butyl group and a 4-methylphenoxy moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine structure suggests potential biological activity, as piperidine derivatives are often explored for their roles in medicinal chemistry, including as potential therapeutic agents. The compound's specific interactions, stability, and reactivity would depend on its molecular structure and the functional groups present, making it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₁₈H₂₉NO·ClH

InChI: InChI=1S/C18H29NO.ClH/c1-14-8-9-17(16(13-14)18(2,3)4)20-12-10-15-7-5-6-11-19-15;/h8-9,13,15,19H,5-7,10-12H2,1-4H3;1H

InChI key: InChIKey=FATYTNIPCONJCA-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(C(C)(C)C)C=C(C)C=C2.Cl

Synonyms:

• Piperidine, 2-[2-[2-(1,1-dimethylethyl)-4-methylphenoxy]ethyl]-, hydrochloride (1:1)