CymitQuimica logo

CAS 1219957-03-5

:

Pyridine, 2-bromo-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)

Description:
Pyridine, 2-bromo-6-(4-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 2-position and a piperidinylmethoxy group at the 6-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with biological targets, possibly influencing neurotransmitter systems or other cellular processes. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.
Formula:C11H15BrN2O·ClH
InChI:InChI=1S/C11H15BrN2O.ClH/c12-10-2-1-3-11(14-10)15-8-9-4-6-13-7-5-9;/h1-3,9,13H,4-8H2;1H
InChI key:InChIKey=SCKAPLIIVHEYGE-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C=2N=C(Br)C=CC2.Cl
Synonyms:
  • Pyridine, 2-bromo-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.