CAS 1219957-04-6

Piperidine, 3-[2-nitro-4-(trifluoromethyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-nitro-4-(trifluoromethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a nitro group and a trifluoromethyl group on the phenoxy substituent contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The trifluoromethyl group often imparts significant effects on the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities would require further investigation. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with nitro and trifluoromethyl functionalities, which can exhibit unique toxicological profiles.

Formula: C₁₂H₁₃F₃N₂O₃·ClH

InChI: InChI=1S/C12H13F3N2O3.ClH/c13-12(14,15)8-3-4-11(10(6-8)17(18)19)20-9-2-1-5-16-7-9;/h3-4,6,9,16H,1-2,5,7H2;1H

InChI key: InChIKey=QFKNDEGULPSJFH-UHFFFAOYSA-N

SMILES: O(C1=C(N(=O)=O)C=C(C(F)(F)F)C=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[2-nitro-4-(trifluoromethyl)phenoxy]-, hydrochloride (1:1)