CymitQuimica logo

CAS 1219957-06-8

:

2-Chloro-N1,N1-di-2-propen-1-yl-1,4-benzenediamine

Description:
2-Chloro-N1,N1-di-2-propen-1-yl-1,4-benzenediamine, identified by its CAS number 1219957-06-8, is an organic compound characterized by its aromatic structure and the presence of both a chloro group and a di-2-propen-1-yl substituent. This compound features a benzene ring with two amino groups (–NH2) at the 1 and 4 positions, which are key functional groups that contribute to its reactivity and potential applications in various chemical processes. The chloro substituent enhances its electrophilic character, making it suitable for further chemical modifications. The presence of the di-2-propen-1-yl groups indicates that it may participate in polymerization reactions, potentially serving as a monomer or an intermediate in the synthesis of more complex materials. Overall, this compound's unique structure suggests potential utility in fields such as organic synthesis, materials science, and possibly in the development of pharmaceuticals, although specific applications would depend on further research and characterization.
Formula:C12H15ClN2
InChI:InChI=1S/C12H15ClN2/c1-3-7-15(8-4-2)12-6-5-10(14)9-11(12)13/h3-6,9H,1-2,7-8,14H2
InChI key:InChIKey=OJUIXPCQHDEYRA-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=C(Cl)C=C(N)C=C1
Synonyms:
  • 1,4-Benzenediamine, 2-chloro-N1,N1-di-2-propen-1-yl-
  • 2-Chloro-N1,N1-di-2-propen-1-yl-1,4-benzenediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.