CymitQuimica logo

CAS 1219957-08-0

:

4-Bromo-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine

Description:
4-Bromo-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine is an organic compound characterized by its complex structure, which includes a bromine atom, a methyl group, and a tetrahydro-2H-pyran moiety attached to a benzene ring. This compound features two amine functional groups, which contribute to its potential reactivity and solubility in various solvents. The presence of the bromine atom suggests that it may participate in electrophilic substitution reactions, while the tetrahydro-2H-pyran group can influence its steric and electronic properties. The compound's molecular structure indicates it may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for applications in drug formulation and synthesis. Overall, this compound's unique features make it a subject of interest for further research in organic synthesis and pharmacology.
Formula:C13H19BrN2O
InChI:InChI=1S/C13H19BrN2O/c1-16(9-10-4-6-17-7-5-10)13-3-2-11(14)8-12(13)15/h2-3,8,10H,4-7,9,15H2,1H3
InChI key:InChIKey=ZSIUYIRNIBGFRQ-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(N)C=C(Br)C=C2
Synonyms:
  • 4-Bromo-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
  • 1,2-Benzenediamine, 4-bromo-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.