CAS 1219957-23-9

Methanone, (3,4-dihydro-2(1H)-isoquinolinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)

Description:

Methanone, (3,4-dihydro-2(1H)-isoquinolinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1), identified by CAS number 1219957-23-9, is a chemical compound characterized by its complex structure, which includes isoquinoline and pyrazolo-pyridine moieties. This compound is typically encountered as a hydrochloride salt, indicating it is soluble in water and may exhibit different properties compared to its free base form. The presence of multiple heterocycles suggests potential biological activity, making it of interest in medicinal chemistry. Its molecular structure may contribute to interactions with biological targets, potentially influencing pharmacological effects. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the functional groups present. As with many synthetic compounds, safety data and handling precautions are essential, particularly due to the potential for biological activity. Further research would be necessary to elucidate its specific applications and mechanisms of action in biological systems.

Formula: C₁₆H₁₈N₄O·ClH

InChI: InChI=1S/C16H18N4O.ClH/c21-16(15-13-9-17-7-5-14(13)18-19-15)20-8-6-11-3-1-2-4-12(11)10-20;/h1-4,17H,5-10H2,(H,18,19);1H

InChI key: InChIKey=VNVJXAIRKYYHLT-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(NN1)CCNC2)N3CC=4C(CC3)=CC=CC4.Cl

Synonyms:

• Methanone, (3,4-dihydro-2(1H)-isoquinolinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)