CAS 1219957-33-1

3-Pyrrolidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)

Description:

3-Pyrrolidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This substance features a cyclohexyl and a methyl group attached to the nitrogen atom of the pyrrolidine, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The compound is likely to exhibit basic properties due to the presence of the amine functional group, making it a potential candidate for various applications in medicinal chemistry and drug development. Its molecular interactions may involve hydrogen bonding and van der Waals forces, influencing its biological activity and pharmacokinetics. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's structural features suggest potential utility in therapeutic contexts, although specific applications would depend on further research and characterization.

Formula: C₁₁H₂₂N₂·2ClH

InChI: InChI=1S/C11H22N2.2ClH/c1-13(11-7-8-12-9-11)10-5-3-2-4-6-10;;/h10-12H,2-9H2,1H3;2*1H

InChI key: InChIKey=GVTVRWJUEIBSBM-UHFFFAOYSA-N

SMILES: N(C)(C1CCNC1)C2CCCCC2.Cl

Synonyms:

• 3-Pyrrolidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)