CymitQuimica logo

CAS 1219957-50-2

:

Propanamide, 2-amino-N-(3-hydroxypropyl)-2-methyl-, hydrochloride (1:1)

Description:
Propanamide, 2-amino-N-(3-hydroxypropyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests that it can act as a base, while the hydroxypropyl substituent contributes to its hydrophilicity. This compound is likely to exhibit solubility in polar solvents, such as water, due to its ionic nature when in hydrochloride form. The methyl group attached to the amide nitrogen may influence its steric properties and overall reactivity. Additionally, the hydrochloride form indicates that the compound is a salt, which can enhance its stability and facilitate handling. Its structural features suggest potential applications in pharmaceuticals or biochemistry, particularly in areas involving enzyme inhibition or as a building block for more complex molecules. As with many amides, it may also exhibit moderate to low toxicity, but specific safety data should be consulted for handling and usage guidelines.
Formula:C7H16N2O2·ClH
InChI:InChI=1S/C7H16N2O2.ClH/c1-7(2,8)6(11)9-4-3-5-10;/h10H,3-5,8H2,1-2H3,(H,9,11);1H
InChI key:InChIKey=XLZWBZMUFVEHGW-UHFFFAOYSA-N
SMILES:C(NCCCO)(C(C)(C)N)=O.Cl
Synonyms:
  • Propanamide, 2-amino-N-(3-hydroxypropyl)-2-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.