CymitQuimica logo

CAS 1219957-52-4

:

5-Bromo-N-cyclopentyl-3-methyl-2-pyridinamine

Description:
5-Bromo-N-cyclopentyl-3-methyl-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a bromine atom, a cyclopentyl group, and a pyridinamine moiety. The presence of the bromine atom introduces halogen characteristics, which can influence the compound's reactivity and solubility. The cyclopentyl group contributes to the compound's hydrophobic properties, potentially affecting its interaction with biological systems. The methyl group at the 3-position of the pyridine ring can enhance lipophilicity, impacting the compound's pharmacokinetics if it is considered for medicinal applications. Additionally, the amino group in the pyridine structure can participate in hydrogen bonding, which may be relevant for its biological activity. Overall, this compound's characteristics suggest potential utility in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C11H15BrN2
InChI:InChI=1S/C11H15BrN2/c1-8-6-9(12)7-13-11(8)14-10-4-2-3-5-10/h6-7,10H,2-5H2,1H3,(H,13,14)
InChI key:InChIKey=KPHMNDOUIHBQCV-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=C(Br)C=N1)C2CCCC2
Synonyms:
  • 2-Pyridinamine, 5-bromo-N-cyclopentyl-3-methyl-
  • 5-Bromo-N-cyclopentyl-3-methyl-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.