CymitQuimica logo

CAS 1219957-61-5

:

Piperidine, 3-[2-(2,4-dibromophenoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[2-(2,4-dibromophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 2-(2,4-dibromophenoxy)ethyl substituent, indicating the presence of a dibromophenyl group linked through an ether bond to an ethyl chain. This structure contributes to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of bromine atoms in the dibromophenyl moiety may enhance lipophilicity and influence the compound's interaction with biological targets. The compound's specific properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the presence of functional groups. Overall, this substance may be of interest in medicinal chemistry and pharmacology due to its structural features and potential therapeutic applications.
Formula:C13H17Br2NO·ClH
InChI:InChI=1S/C13H17Br2NO.ClH/c14-11-3-4-13(12(15)8-11)17-7-5-10-2-1-6-16-9-10;/h3-4,8,10,16H,1-2,5-7,9H2;1H
InChI key:InChIKey=ZFDWQIWLDWOMHW-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(Br)C=C(Br)C=C2.Cl
Synonyms:
  • Piperidine, 3-[2-(2,4-dibromophenoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.