CAS 1219957-62-6

5-Bromo-4-methyl-N-phenyl-2-pyridinamine

Description:

5-Bromo-4-methyl-N-phenyl-2-pyridinamine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom, a methyl group, and a phenyl group. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The bromine substituent can influence the compound's reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the methyl and phenyl groups can also affect the compound's electronic properties and steric hindrance, which may impact its biological activity and interactions with other molecules. Additionally, compounds like this may be of interest in pharmaceutical research due to their potential applications in drug development or as intermediates in organic synthesis. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks.

Formula: C₁₂H₁₁BrN₂

InChI: InChI=1S/C12H11BrN2/c1-9-7-12(14-8-11(9)13)15-10-5-3-2-4-6-10/h2-8H,1H3,(H,14,15)

InChI key: InChIKey=PVVULYIUQLVRCA-UHFFFAOYSA-N

SMILES: N(C1=CC(C)=C(Br)C=N1)C2=CC=CC=C2

Synonyms:

• 2-Pyridinamine, 5-bromo-4-methyl-N-phenyl-
• 5-Bromo-4-methyl-N-phenyl-2-pyridinamine