
CAS 1219957-63-7
:1H-Azepine, hexahydro-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2)
Description:
1H-Azepine, hexahydro-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a hexahydro-1H-azepine ring and a piperidine moiety. This compound is typically classified as a cyclic amine and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form indicates that it is a hydrochloride, which enhances its solubility in water and may improve its bioavailability. The presence of the piperidine group suggests that it may exhibit properties related to neurotransmitter modulation, making it of interest in neuropharmacology. Its molecular structure contributes to its unique reactivity and interaction with biological systems. As with many compounds in this class, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic applications.
Formula:C13H26N2·2ClH
InChI:InChI=1S/C13H26N2.2ClH/c1-2-6-11-15(10-5-1)12-8-13-7-3-4-9-14-13;;/h13-14H,1-12H2;2*1H
InChI key:InChIKey=NPQVDSZZYHYQHL-UHFFFAOYSA-N
SMILES:C(CC1CCCCN1)N2CCCCCC2.Cl
Synonyms:- 1H-Azepine, hexahydro-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.