CymitQuimica logo

CAS 1219957-70-6

:

Piperidine, 3-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a side chain that includes a bromo-substituted aromatic moiety, specifically a 4-methylphenoxy group, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom may impart specific reactivity and influence the compound's interaction with biological targets. This compound is of interest in medicinal chemistry, potentially serving as a lead compound for the development of new therapeutic agents. Its structural characteristics suggest it may exhibit various pharmacological effects, although specific biological activities would require further investigation through experimental studies. Safety and handling precautions should be observed due to the presence of bromine and the compound's potential biological activity.
Formula:C14H20BrNO·ClH
InChI:InChI=1S/C14H20BrNO.ClH/c1-11-4-5-14(13(15)9-11)17-8-6-12-3-2-7-16-10-12;/h4-5,9,12,16H,2-3,6-8,10H2,1H3;1H
InChI key:InChIKey=MILPZGCGSFLHEG-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(Br)C=C(C)C=C2.Cl
Synonyms:
  • Piperidine, 3-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.