
CAS 1219957-72-8
:1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1)
Description:
1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo and pyridine moiety. This compound features a carboxamide functional group, contributing to its potential biological activity. The presence of the tetrahydro-2-furanyl group suggests that it may exhibit unique interactions due to its cyclic ether structure, which can influence solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure indicates potential uses in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Further studies would be necessary to elucidate its pharmacological profile and potential applications.
Formula:C12H18N4O2·ClH
InChI:InChI=1S/C12H18N4O2.ClH/c17-12(14-6-8-2-1-5-18-8)11-9-7-13-4-3-10(9)15-16-11;/h8,13H,1-7H2,(H,14,17)(H,15,16);1H
InChI key:InChIKey=HZIWPJVACBUMCY-UHFFFAOYSA-N
SMILES:C(NCC1CCCO1)(=O)C=2C3=C(NN2)CCNC3.Cl
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, 4,5,6,7-tetrahydro-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.