CymitQuimica logo

CAS 1219960-32-3

:

3-Pyrrolidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)

Description:
3-Pyrrolidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound is a derivative of pyrrolidine and is modified with two propenyl groups, enhancing its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. The presence of the amine functional group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could influence biological activity or polymerization behavior. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H20N2·2ClH
InChI:InChI=1S/C11H20N2.2ClH/c1-3-7-13(8-4-2)10-11-5-6-12-9-11;;/h3-4,11-12H,1-2,5-10H2;2*1H
InChI key:InChIKey=GOTRODJKSZTMOF-UHFFFAOYSA-N
SMILES:C(N(CC=C)CC=C)C1CCNC1.Cl
Synonyms:
  • 3-Pyrrolidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.