CAS 1219960-34-5

2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-4-pyridinecarboxylic acid

Description:

2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-4-pyridinecarboxylic acid, identified by its CAS number 1219960-34-5, is a chemical compound characterized by its unique structure that includes a pyridine ring and a tetrahydropyran moiety. This compound features an amino group attached to a pyridinecarboxylic acid, which contributes to its potential as a bioactive molecule. The presence of the tetrahydropyran ring suggests that it may exhibit interesting stereochemical properties and could participate in various chemical reactions, including those typical of amines and carboxylic acids. Its solubility and reactivity can be influenced by the functional groups present, making it a candidate for applications in medicinal chemistry and drug development. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored in pharmacological studies. Overall, its structural complexity and functional groups position it as a potentially valuable compound in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₂H₁₆N₂O₃

InChI: InChI=1S/C12H16N2O3/c15-12(16)10-1-4-13-11(7-10)14-8-9-2-5-17-6-3-9/h1,4,7,9H,2-3,5-6,8H2,(H,13,14)(H,15,16)

InChI key: InChIKey=LBEICPACIGCTPA-UHFFFAOYSA-N

SMILES: N(CC1CCOCC1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-[[(tetrahydro-2H-pyran-4-yl)methyl]amino]-

2-[(Tetrahydro-2H-pyran-4-ylmethyl)amino]isonicotinic acid

CAS: 1219960-34-5

Formula: C₁₂H₁₆N₂O₃

Molecular weight: 236.271

Ref: 10-F096956