CAS 1219960-35-6

3-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2)

Description:

3-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which contributes to its potential biological activity. This substance features a methyl group and a phenylmethyl group attached to the nitrogen atom of the pyrrolidine, enhancing its lipophilicity and possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential neurotransmitter modulator or having effects on the central nervous system, although specific biological activities would depend on further research. Its molecular structure suggests it may participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity.

Formula: C₁₃H₂₀N₂·2ClH

InChI: InChI=1S/C13H20N2.2ClH/c1-15(11-13-7-8-14-9-13)10-12-5-3-2-4-6-12;;/h2-6,13-14H,7-11H2,1H3;2*1H

InChI key: InChIKey=CIISAMSSCLNVSH-UHFFFAOYSA-N

SMILES: C(N(CC1CCNC1)C)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2)