CAS 1219960-37-8

3-(2-Ethylbutyl)pyrrolidine

Description:

3-(2-Ethylbutyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the 2-ethylbutyl substituent introduces a branched alkyl group, contributing to the compound's hydrophobic nature and potentially influencing its solubility and volatility. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its reactivity and interactions with other substances. Its structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. Additionally, the presence of the nitrogen atom in the ring may impart unique characteristics, such as the ability to participate in nucleophilic reactions. However, specific physical and chemical properties, such as boiling point, melting point, and reactivity, would require empirical data for precise characterization. Safety data should also be consulted, as with any chemical substance, to understand its handling and potential hazards.

Formula: C₁₀H₂₁N

InChI: InChI=1S/C10H21N/c1-3-9(4-2)7-10-5-6-11-8-10/h9-11H,3-8H2,1-2H3

InChI key: InChIKey=OQHVZYFLWMHQSX-UHFFFAOYSA-N

SMILES: C(C(CC)CC)C1CCNC1

Synonyms:

• 3-(2-Ethylbutyl)pyrrolidine
• Pyrrolidine, 3-(2-ethylbutyl)-