
CAS 1219960-38-9
:2-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)
Description:
2-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a butyl and a methyl group attached to the nitrogen atom of the piperidine, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and research. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the compound's molecular structure may impart specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and potential therapeutic uses. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C11H24N2·2ClH
InChI:InChI=1S/C11H24N2.2ClH/c1-3-4-9-13(2)10-11-7-5-6-8-12-11;;/h11-12H,3-10H2,1-2H3;2*1H
InChI key:InChIKey=BWUKZXVWCHBUCJ-UHFFFAOYSA-N
SMILES:C(N(CCCC)C)C1CCCCN1.Cl
Synonyms:- 2-Piperidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.