CAS 1219960-42-5
:Hexahydro-4-(2-methoxyethyl)-5H-1,4-diazepin-5-one
Description:
Hexahydro-4-(2-methoxyethyl)-5H-1,4-diazepin-5-one is a chemical compound characterized by its unique bicyclic structure, which includes a diazepine ring. This compound features a hexahydro framework, indicating that it is fully saturated with hydrogen atoms, contributing to its stability and potential solubility in organic solvents. The presence of the methoxyethyl group enhances its polarity, which may influence its interactions in biological systems or chemical reactions. The compound is likely to exhibit properties typical of diazepines, such as potential pharmacological activity, although specific biological effects would depend on its interaction with various receptors or enzymes. Its molecular structure suggests it may participate in hydrogen bonding due to the presence of the carbonyl group, which can affect its reactivity and solubility. Overall, Hexahydro-4-(2-methoxyethyl)-5H-1,4-diazepin-5-one represents a class of compounds that may have applications in medicinal chemistry or as intermediates in organic synthesis.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c1-12-7-6-10-5-4-9-3-2-8(10)11/h9H,2-7H2,1H3
InChI key:InChIKey=OZXNBFWMSDPPOM-UHFFFAOYSA-N
SMILES:C(COC)N1C(=O)CCNCC1
Synonyms:- 5H-1,4-Diazepin-5-one, hexahydro-4-(2-methoxyethyl)-
- Hexahydro-4-(2-methoxyethyl)-5H-1,4-diazepin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.