CAS 1219960-45-8

Hexahydro-4-[(4-methoxyphenyl)methyl]-5H-1,4-diazepin-5-one

Description:

Hexahydro-4-[(4-methoxyphenyl)methyl]-5H-1,4-diazepin-5-one is a chemical compound characterized by its unique bicyclic structure, which includes a diazepine ring. This compound features a hexahydro framework, indicating it is saturated and contains six hydrogen atoms in its cyclic structure. The presence of a 4-methoxyphenyl group suggests that it has an aromatic character, contributing to its potential biological activity and solubility properties. The methoxy group (-OCH3) enhances the compound's lipophilicity, which can influence its interaction with biological membranes. Additionally, the carbonyl group (C=O) in the diazepinone structure may play a role in its reactivity and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and biological activity, would depend on its molecular interactions and the presence of functional groups. Overall, Hexahydro-4-[(4-methoxyphenyl)methyl]-5H-1,4-diazepin-5-one represents a class of compounds that could have diverse applications in drug development and therapeutic research.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1S/C13H18N2O2/c1-17-12-4-2-11(3-5-12)10-15-9-8-14-7-6-13(15)16/h2-5,14H,6-10H2,1H3

InChI key: InChIKey=KLNQDLOSSPFAMS-UHFFFAOYSA-N

SMILES: C(N1C(=O)CCNCC1)C2=CC=C(OC)C=C2

Synonyms:

• 5H-1,4-Diazepin-5-one, hexahydro-4-[(4-methoxyphenyl)methyl]-
• Hexahydro-4-[(4-methoxyphenyl)methyl]-5H-1,4-diazepin-5-one