CymitQuimica logo

CAS 1219960-46-9

:

Piperidine, 4-(2,4-dibromophenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(2,4-dibromophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 2,4-dibromophenoxy group, indicating the presence of bromine substituents on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride group also suggests that it may exhibit properties such as improved stability and ease of handling. This compound may be of interest in medicinal chemistry due to its potential biological activities, which could include effects on neurotransmitter systems or other physiological pathways. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies. Overall, the unique structural features of this compound make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C11H13Br2NO·ClH
InChI:InChI=1S/C11H13Br2NO.ClH/c12-8-1-2-11(10(13)7-8)15-9-3-5-14-6-4-9;/h1-2,7,9,14H,3-6H2;1H
InChI key:InChIKey=KCFRMUOUMMALFK-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(Br)C=C1)C2CCNCC2.Cl
Synonyms:
  • Piperidine, 4-(2,4-dibromophenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.